On Target SC6A4_HUMAN 0.35036495/CHEMBL561332
For the given ligand Peramivir, we have found in our database that, being scored 0.35036495, the most similar ligand is CHEMBL561332. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL561332 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | COc1ccc(cc1)[C@@H](C)N[C@@H]2CC[C@@H](C(=O)N3CCC(CC3)(N4CCCOC4=O)c5ccccc5)C(C)(C)C2 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01c01e08 20100108 80010600 00001000 08008000 02040000 22001000 00000a00 000809e0 08300000 50019000 0400881a 00000100 01000401 001e0008 00220000 02080000 02802800 00020201 80000100 181c8eb0 01000080 0050001c 00000001 c0001002 00320000 90200000 00000300 0006001f a0060000 00002600 |