On Target HYES_HUMAN 0.34848484/CHEMBL375113
For the given ligand Zanamivir, we have found in our database that, being scored 0.34848484, the most similar ligand is CHEMBL375113. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL375113 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | OC[C@@H]1O[C@H](NC(=O)CNC(=O)CCCCCCCCCCCNC(=O)NC23CC4CC(CC(C4)C2)C3)[C@@H](O)[C@H](O)[C@H]1O |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00010000 01407001 00100000 04010d00 803800c0 00010000 00020004 a0002008 00800200 01000080 00200000 4001b000 0600900a 03802100 80100000 001a9008 10000000 00000000 13c02840 00000201 00000120 30150610 07000081 0a100038 00010401 00001002 00000000 10200060 08000200 00040001 a00a4000 00000a00 |