On Target AMPN_HUMAN 0.26630434/CHEMBL28650
For the given ligand Zanamivir, we have found in our database that, being scored 0.26630434, the most similar ligand is CHEMBL28650. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL28650 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CC(C)C[C@@H](N)[C@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00050000 01007400 00100000 04000400 00280080 00000000 00000000 20000008 00000000 00000180 00200000 40017000 0e00800a 00002003 80180000 00080008 10000000 00000001 00c02010 00000201 00000000 30100e10 03000083 02100018 00001001 00000000 00000000 10000000 08000002 00040011 20004000 00002200 |