On Target AMPN_HUMAN 0.41584158/CHEMBL28650
For the given ligand Peramivir, we have found in our database that, being scored 0.41584158, the most similar ligand is CHEMBL28650. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL28650 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CC(C)C[C@@H](N)[C@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00050000 01007400 00100000 04000400 00280080 00000000 00000000 20000008 00000000 00000180 00200000 40017000 0e00800a 00002003 80180000 00080008 10000000 00000001 00c02010 00000201 00000000 30100e10 03000083 02100018 00001001 00000000 00000000 10000000 08000002 00040011 20004000 00002200 |