On Target ADRB2_HUMAN 0.33114755/CHEMBL236040
For the given ligand Baloxavir, we have found in our database that, being scored 0.33114755, the most similar ligand is CHEMBL236040. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL236040 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CSc1ccccc1CNC(=O)c2cc3cc(C[C@@H](C)NC[C@H](O)c4ccc(O)c(CO)c4)ccc3[nH]2 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00000003 0080ca08 20120100 10110e00 000410a1 00304020 02000000 02003801 00000980 00080840 a8390004 60008000 10008802 00500000 000a0440 020c210c 14002000 02000006 00200000 40020201 c0000100 18268628 22802000 8140001d 00102000 d0000000 00520040 80000000 04400104 00060003 c0040200 00016620 |