On Target CASP1_HUMAN 0.32285714/CHEMBL437526
For the given ligand Baloxavir, we have found in our database that, being scored 0.32285714, the most similar ligand is CHEMBL437526. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL437526 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CCO[C@@H]1OC(=O)C[C@@H]1NC(=O)[C@@H]2CCCN3N2C(=O)[C@H](CCC3=O)NC(=O)c4nccc5ccccc45 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00078006 01007800 00104340 94010f00 002400a0 00100000 00010800 2a003019 02200000 00030ce8 0039001c 4003b004 0e008812 00702001 a01a15c8 022c110c 10260000 02000103 14f08010 10000a01 c0000020 38178e28 7380e083 8250001c 00101401 c0000100 00810040 b4000001 09000304 000e0003 a044e000 00846208 |