On Target PPAP_HUMAN 0.088/CHEMBL501717
For the given ligand Peramivir, we have found in our database that, being scored 0.088, the most similar ligand is CHEMBL501717. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL501717 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | Cl.C[C@@H](N[C@H](c1ccccc1)P(=O)(O)O)c2ccccc2 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00080840 08200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400010 00000000 c6010006 00000000 80014000 00000100 30060002 00040000 00028603 |