On Target CHLE_HUMAN 0.3258427/CHEMBL504924
For the given ligand Zanamivir, we have found in our database that, being scored 0.3258427, the most similar ligand is CHEMBL504924. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL504924 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CN[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4[C@@H](OC(=O)C)[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)NC(=O)\C(=C\C)\C |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00000000 0100d000 00100300 80010700 00080080 00000000 00100000 20000400 01000000 00000080 00200000 c0019000 00008002 00810000 00081008 00081008 30860000 00000100 02412000 00000201 00000020 10040e10 13000000 00100018 00000400 00000000 00c80000 10000001 00000200 01040003 04020000 02002200 |