On Target ACM4_HUMAN 0.3105023/CHEMBL120080
For the given ligand Laninamivir, we have found in our database that, being scored 0.3105023, the most similar ligand is CHEMBL120080. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL120080 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CCCCCCCCOC(=O)C1=C(CCN(CC)C1)c2ccccc2.OC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00040050 09008200 00100100 00010700 00080000 00000800 82180180 30000400 05800800 005808c8 48300000 4000d000 0c008102 00890000 00000002 000c1008 20a20400 02000140 20c1a01a 00800201 00000120 18000a80 05008080 00400010 00001401 80000400 00482000 50010400 00400200 0006040a 04020000 00002610 |