On Target ACM4_HUMAN 0.3110048/CHEMBL120080
For the given ligand Zanamivir, we have found in our database that, being scored 0.3110048, the most similar ligand is CHEMBL120080. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL120080 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CCCCCCCCOC(=O)C1=C(CCN(CC)C1)c2ccccc2.OC(=O)C(=O)O |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00040050 09008200 00100100 00010700 00080000 00000800 82180180 30000400 05800800 005808c8 48300000 4000d000 0c008102 00890000 00000002 000c1008 20a20400 02000140 20c1a01a 00800201 00000120 18000a80 05008080 00400010 00001401 80000400 00482000 50010400 00400200 0006040a 04020000 00002610 |