On Target ACM4_HUMAN 0.29700273/CHEMBL318995
For the given ligand Baloxavir, we have found in our database that, being scored 0.29700273, the most similar ligand is CHEMBL318995. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL318995 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CCCCc1[nH]c2ccc3OC4N(CCc5cc(SC)ccc45)Cc3c2c1C(=O)OCC |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0400000a 0180da08 6012010b 90110610 00041030 0001c500 171c0000 22021404 14c00b80 00180c40 48308004 60808800 80808886 0061a000 010204e1 0a1e200c 04022209 06088024 0021000a 40020201 c8420d40 183a8a78 20804020 81c0301d 00046400 c0012223 084a4040 80000080 04400305 00860002 e4048204 20010621 |