On Target TNFA_HUMAN 0.2851711/CHEMBL2337619
For the given ligand Zanamivir, we have found in our database that, being scored 0.2851711, the most similar ligand is CHEMBL2337619. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL2337619 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CCCCCCOC(=O)\C=C\c1cc(OC)c(O)c2c1C[C@@H]3[C@@H]4C=C(OC)C(=O)C[C@]24CCN3C |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |