On Target DRD2_HUMAN 0.33624455/CHEMBL539521
For the given ligand Zanamivir, we have found in our database that, being scored 0.33624455, the most similar ligand is CHEMBL539521. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL539521 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | Cl.Fc1ccc(cc1)C(=O)CCCN2CCCC3(C2)OC(=CC3=O)c4ccccc4 |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00030000 01000a00 00100302 82010701 00100090 00004010 80000080 20000400 11900900 003808c0 08301200 5001d000 8c028012 00211000 0228140e 03081008 10004404 82000080 0045e010 00100201 00004120 58020230 13008020 00500014 01001400 80002000 00487200 d0002001 04404240 00068002 e6040000 02826e00 |