On Target DRD2_HUMAN 0.32343236/CHEMBL2159468
For the given ligand Baloxavir, we have found in our database that, being scored 0.32343236, the most similar ligand is CHEMBL2159468. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL2159468 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CC(C)c1ccccc1OCCN2CCC(C2)NC(=O)c3ccc4ccccc4n3 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 04002002 00003c08 20104108 14010e02 000410a0 80100010 02000000 22003209 00000000 000909e0 08290004 40008000 00808802 00502000 011a1441 020c210c 10000000 02028002 00200000 00020201 40000000 380f8608 32802000 8240001c 00100000 c0000000 00000040 90000001 08000304 00060013 a0040000 00004600 |