On Target DRD2_HUMAN 0.35135135/CHEMBL2436139
For the given ligand Peramivir, we have found in our database that, being scored 0.35135135, the most similar ligand is CHEMBL2436139. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL2436139 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | Cl.CC(C)C[C@H](NC(=O)[C@@H]1N[C@@H](CN=[N+]=[N-])C[C@H]1CN=[N+]=[N-])C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00030010 01007400 00102000 04000400 00000180 00010010 00000000 20000008 00200000 00000180 00200000 70033000 0600801a 00002001 80180001 00080008 30000000 00000000 00002001 80000201 00000000 30040e30 02000003 02100018 00000002 00000000 90000000 10000010 08100000 00040011 20004000 00022200 |