On Target NEP_HUMAN 0.3671875/CHEMBL434492
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3671875, the most similar ligand is CHEMBL434492. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL434492 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | COCCOC[C@H](CC1(CCCC1)C(=O)N[C@@H]2CC[C@@H](CC2)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00010000 01001000 00100000 00010500 000c0040 00200000 00000000 20000040 00002000 01020080 00200000 40019000 1400803a 01800000 00000000 00089008 00800000 00000000 03402000 00000201 00000020 10040e10 05000000 08100018 00000400 00000000 00000000 10000020 00000200 01040001 00020000 00002200 |