On Target NOS1_HUMAN 0.30243903/CHEMBL1270460
For the given ligand Laninamivir, we have found in our database that, being scored 0.30243903, the most similar ligand is CHEMBL1270460. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL1270460 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | Fc1cccc(CCNCCO[C@H]2CNC[C@H]2CC3CCCC(=N)N3)c1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00000000 01000000 00100100 82010f00 00180080 00000010 00000000 20002000 00200280 000828c3 08210000 50038000 00000002 00881000 00081008 00181008 10a00000 02000000 00c02000 00000201 00000020 18230030 13000080 81500010 30000400 80000000 c0000200 10000001 04200210 00068002 80020000 00002e00 |