On Target NOS1_HUMAN 0.29393938/CHEMBL491923
For the given ligand Baloxavir, we have found in our database that, being scored 0.29393938, the most similar ligand is CHEMBL491923. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL491923 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Cn1cncc1C(=O)N(CC2=CC(=O)Nc3c(F)c(F)ccc23)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 1000c002 01a00800 00104102 07010e10 00060040 00100070 08004000 0a003001 06000100 40200860 4429800c 5000c800 82009806 00701001 00120440 000c0004 00063008 02402102 88600000 401a4000 c0100001 18018f08 21812000 c0500008 01046000 c0000401 00000020 80000893 00008104 04478001 c0048804 80020220 |