On Target NOS1_HUMAN 0.5/CHEMBL332148
For the given ligand Peramivir, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL332148. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL332148 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CN[C@@H](CCCNC(=N)N)C(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01000000 00100000 00000c00 00080080 00000000 00000000 00002000 00200200 00000082 00200000 40033000 04009010 01000000 00000000 00180008 00000000 00000000 00400000 00000001 00000000 10010a00 03000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 80084000 00000200 |