On Target NK1R_HUMAN 0.40343347/CHEMBL1090438
For the given ligand Laninamivir, we have found in our database that, being scored 0.40343347, the most similar ligand is CHEMBL1090438. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL1090438 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | C[C@@H](O[C@H]1CN2C(CC(=CC2=O)C3CCOCC3)[C@@H]1c4ccc(F)cc4)c5cc(cc(c5)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00000010 890dd200 00100102 82010700 800800d1 00004010 00180580 20000444 01000980 001808d8 08301000 c0018002 00028102 01a91000 000c1408 020c1108 38a00000 020001c0 44c12002 40102201 00010120 183406b0 13008080 81500018 00000401 80002000 00c84000 90000001 04000202 0006840b 64120004 02002600 |