On Target OPRK_HUMAN 0.37676057/CHEMBL1743604
For the given ligand Laninamivir, we have found in our database that, being scored 0.37676057, the most similar ligand is CHEMBL1743604. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL1743604 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CN(C)[C@@H](Cc1c(C)cc(O)cc1C)C(=O)N2Cc3ccccc3C[C@H]2C(=O)OC4=C5O[C@H]6[C@@H](O)C=C[C@H]7[C@H]8CC(C=C4)C5[C@@]67CCN8C.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00248048 c9845608 20100900 94010701 405820a1 00000801 03081000 3a001406 10000889 405908c8 48300200 5141f210 86028882 03a02001 8218148c 030d900c 10824204 02000060 22416098 0022a205 80020120 38209e30 1700e041 8b50001a 04221c00 c0000401 00d24200 90000021 0c014340 0086041b 24064800 00806e10 |