On Target OPRK_HUMAN 0.45762712/CHEMBL4112830
For the given ligand Peramivir, we have found in our database that, being scored 0.45762712, the most similar ligand is CHEMBL4112830. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL4112830 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CC(C)C[C@@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](N)Cc2ccccc2)C(=O)N[C@H](CCCCNC(=N)N)C(=O)N3CCC(N)(CC3)C(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00030000 01003600 00100100 04010e00 00100000 00000000 00000000 2000200c 00000a80 000809c2 08300000 5001b000 0600900a 00002001 80000000 001c0008 00000000 02000000 00402008 00000201 00000100 382d0e30 03000003 83500018 00000800 80000000 40000000 10000000 0c000010 0006001b a0084000 00802e00 |