On Target ALDR_HUMAN 0.31282052/CHEMBL269550
For the given ligand Zanamivir, we have found in our database that, being scored 0.31282052, the most similar ligand is CHEMBL269550. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL269550 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CCOC(=O)C1=C(O)C(=O)N(Cc2ccccc2)C1 |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00000008 00809000 00100100 10010600 00000080 08000000 02100000 02001c00 01000000 00000840 40200000 4000d000 88008802 00090000 00080400 00080008 30220800 02000101 20a50010 00000200 80002020 38108f00 03000080 00400018 00001401 c8008800 00480200 80000400 00004300 00060001 2c040000 00000210 |