On Target ALDR_HUMAN 0.24418604/CHEMBL334830
For the given ligand Peramivir, we have found in our database that, being scored 0.24418604, the most similar ligand is CHEMBL334830. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL334830 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | Fc1cc(Br)ccc1CN2C(=O)c3cccn3[C@@]4(CC(=O)NC4=O)C2=O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00024082 0180bc00 00100100 52090e00 00020020 00104010 00000000 22003003 00200100 000109e0 00290004 4003b000 0c009812 00141000 00020c00 04040104 02106200 42000807 00200010 00020a01 80020001 382d8610 20802000 2240001e 08111000 c0000000 00520004 90000001 08040106 01068051 a01c0208 08804200 |