On Target AA1R_HUMAN 0.398374/CHEMBL329774
For the given ligand Peramivir, we have found in our database that, being scored 0.398374, the most similar ligand is CHEMBL329774. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL329774 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCCN1C(=O)C2NC(NC2N(CCCOC(=O)CBr)C1=O)C3CCCC3 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 0300b400 00100100 04010e00 00000000 00000000 00000024 20002008 00000000 000201a0 06200002 4001b000 0f00b102 00082000 80000000 00080008 00220010 00802001 00802050 00000201 00020920 301b0e10 01000081 02100018 00013403 00000000 00000000 10000100 08000200 01040015 08184009 00002200 |