On Target AOFB_HUMAN 0.22014925/CHEMBL522271
For the given ligand Laninamivir, we have found in our database that, being scored 0.22014925, the most similar ligand is CHEMBL522271. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL522271 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CN1C2C(N=C1\C=C\c3ccc(Cl)c(Cl)c3)N(C)C(=O)N(C)C2=O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00008040 0300b000 00300100 04010e00 22000020 00000000 949100c4 1000e409 00000441 00430d63 12202830 4000f800 0b00b006 01012008 80001002 00111080 20019c10 02000101 00100010 00801041 00320100 380b0700 00000000 02400018 00012090 a0100000 404f2000 50411840 0a400010 00068311 0410e00d 00020200 |