On Target AOFB_HUMAN 0.2905983/CHEMBL3604126
For the given ligand Peramivir, we have found in our database that, being scored 0.2905983, the most similar ligand is CHEMBL3604126. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3604126 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CN(Cc1ccc(CC(=O)NC2CC(C)(C)N([O])C(C)(C)C2)cc1)C#C |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00000200 01001410 40100100 00010600 00400000 00000000 04000000 22001004 00000180 000809e0 08200000 50019800 8100880e 00000000 40000000 00000010 00000000 12000000 00402000 00040201 00000000 182c8610 00000000 81400018 00004000 80000000 00000000 90000000 04000120 00060013 00062000 00002600 |