On Target PGH1_SHEEP 0.35751295/CHEMBL502799
For the given ligand Zanamivir, we have found in our database that, being scored 0.35751295, the most similar ligand is CHEMBL502799. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL502799 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CC(C)[C@@H](N(C)C)C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@]3(O)[C@H]2C=C(C)C3=O)[C@@H]4C(C)(C)[C@]14OC(=O)C |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00050040 81000000 00100d08 80010700 002800c0 00000000 00000280 28000442 01002000 01100008 00200200 4000f000 04028028 03800000 0000140c 00099008 00820000 00000000 13412010 02002001 00000020 10000a80 17008000 08000010 10201480 00200400 00404200 80001020 00000200 8004000a 24024000 00000200 |