On Target PGH1_SHEEP 0.28494623/CHEMBL2018668
For the given ligand Baloxavir, we have found in our database that, being scored 0.28494623, the most similar ligand is CHEMBL2018668. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL2018668 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CCN1C(=S)NN=C1CN2N=C(Cc3ccccc3)c4onc(C)c4C2=O |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00040004 00004408 641a1108 22010709 81080485 80120076 06800000 2100360d 06020510 800c09c8 0801c168 74018800 00009007 18e01050 00aa2000 100d258e 10308e00 0282c104 00600060 00260240 10806000 1c038018 61c84801 02780090 04100000 e0014401 10030020 488e1001 01000184 02070252 82000481 40014428 |