On Target CNR1_HUMAN 0.37125748/CHEMBL66956
For the given ligand Baloxavir, we have found in our database that, being scored 0.37125748, the most similar ligand is CHEMBL66956. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL66956 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | COc1cccc2c(nn(CCN3CCOCC3)c12)C(=O)NC(c4ccccc4)c5ccccn5 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0000080e 01801c08 60084109 d0010e02 010c10b0 0018000a 4a0c0000 0300340b 00200800 001808c0 0831802c 48958000 00009806 00e00000 01121c09 020c218c 10242000 02820003 00e00000 40260801 c0000000 3c078618 33804881 0270001c 08304441 e0000000 00220040 c0000001 09000384 00060013 840c8000 2000c720 |