On Target CNR1_HUMAN 0.5/CHEMBL483143
For the given ligand Peramivir, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL483143. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL483143 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCCCCCCCCCCCCCCC(=O)N[C@H]1C[C@H]1O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01005000 00100000 00000400 00000080 00000000 00000000 20000000 00000000 00000080 00200000 40011000 0400800a 01000000 00080000 00080008 10000000 00000000 00802000 00000201 00000000 10100610 03000080 00100018 00000001 00000000 00000000 10000000 00000000 00040001 00020000 00002200 |