On Target NMDE2_HUMAN 0.19087137/CHEMBL247114
For the given ligand Zanamivir, we have found in our database that, being scored 0.19087137, the most similar ligand is CHEMBL247114. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL247114 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | FC(F)(F)Oc1ccc(cc1Cl)C2=NCC(N2)c3ccccc3C(F)(F)F |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00008040 08040008 20300108 1a010600 40001030 00000000 16050400 02001000 00000100 0009085b 18200010 40408800 42000807 0120a008 81040401 20180008 02202800 02000002 00003000 00020000 04220000 38008100 0000401a 83500012 00002080 c0008800 40224000 d0000000 0e200318 00068402 40160080 00020600 |