On Target NMDE2_HUMAN 0.26153848/CHEMBL218068
For the given ligand Peramivir, we have found in our database that, being scored 0.26153848, the most similar ligand is CHEMBL218068. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL218068 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | O=C(OCc1ccccc1)N2CCC(CNc3ccncn3)CC2 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 01010002 01401000 00100100 08090600 20000000 0000e000 00008000 20100800 00200300 000008c0 00200004 50039000 04008002 00010000 00020000 021e000c 00060000 02084400 00400880 00200201 00100000 18040c70 20804040 00500018 00000000 80002002 00000000 10200080 00000208 00460001 c0001000 000002c0 |