On Target P2RX3_HUMAN 0.26143792/CHEMBL3895492
For the given ligand Peramivir, we have found in our database that, being scored 0.26143792, the most similar ligand is CHEMBL3895492. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3895492 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCC1C(=O)N\C(=N/c2ccc(OC(C)C)cc2)\N(Cc3ccc(Cl)cc3)C1=O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 04008042 01800408 20100108 00010e00 00001000 00000000 02000004 22003008 00000300 800209f2 11200004 44009820 0f809846 40000008 010004c1 00180008 00004800 02000000 01000050 00020201 c0012100 1a018700 22000010 00400018 00093000 c8000000 40440000 90000800 00000310 00860211 a00c0000 80020200 |