On Target DRD3_HUMAN 0.33464566/CHEMBL3577342
For the given ligand Zanamivir, we have found in our database that, being scored 0.33464566, the most similar ligand is CHEMBL3577342. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL3577342 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CCCCn1cc(CCCOc2ccc(cc2OC)C(=O)NCCCCN(CCC)[C@H]3COC(=CC3)C#C)nn1 |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 0c000000 de001a18 60700109 80a10719 00493080 42000000 060c2000 22001600 00200800 101808c8 00208000 40038840 8082ca86 00802000 13095409 2a0db00c 30000004 86100040 00484000 00062201 00020020 18068610 130090c0 0054a01c 00200401 c2000100 00620000 92802101 00004304 00060409 bc040000 0400e242 |