On Target AGTR2_HUMAN 0.27789474/CHEMBL507053
For the given ligand Laninamivir, we have found in our database that, being scored 0.27789474, the most similar ligand is CHEMBL507053. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL507053 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CO\C(=C/1\NC(=O)[C@@H](NC(=O)c2csc(n2)c3cc(O)c(nc3c4csc(n4)[C@@H]5COC(=O)c6c7CO[C@@H]([C@H](NC(=O)c8csc1n8)c9nc(cs9)C(=O)N5)[C@H](O[C@H]%10C[C@](C)(O)[C@@H]([C@H](C)O%10)N(C)C)C(=O)OCc%11cccc(c7%11)n6O)c%12nc(cs%12)C(=O)NCCNC(=O)CN(C)C)[C@@H](C)O)\C |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 0047865a 41037809 e6305b44 f48d1f31 b01d50f3 0430c006 c3d03aa2 383bfddf 10622780 1945ccf3 802f9a65 f001fe38 9f0298f6 02f9a063 c2023449 0a3cb95c 10a69841 96a034a6 05e1a018 7242aae5 4090b820 f9179ffb b790708a 8ec5013c 9694b403 ae11a911 68fa0278 b45417e5 0c59c21f 07e61401 ecf45a8c b6810a31 |