On Target OPRM_MOUSE 0.3478261/CHEMBL440765
For the given ligand Peramivir, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL440765. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL440765 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)Cc4ccccc4 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00000040 01003000 00100100 04010700 00180000 00000010 00000000 20000008 00000080 000808c0 08200000 40019000 01008002 01882000 40080000 00081008 00a00000 02000000 02c02000 00000201 00000020 38240610 01000081 83500018 00000401 80000000 00000200 10000000 0c000200 00060003 00022000 00002e00 |