On Target P2Y12_HUMAN 0.31851852/CHEMBL599606
For the given ligand Peramivir, we have found in our database that, being scored 0.31851852, the most similar ligand is CHEMBL599606. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL599606 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(cc(c2)c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 0003a000 01403800 00100100 04010600 00180001 04010000 10000000 22001008 00800200 000308c0 00200000 4001b000 06808832 01002000 00000400 081a0008 00020000 02001000 04400800 00000201 00000000 38068e10 11000023 0250001c 00000000 c0000002 08000000 90200061 18004300 00060001 a0044000 00800a00 |