On Target NOS2_HUMAN 0.2736842/CHEMBL1037
For the given ligand Laninamivir, we have found in our database that, being scored 0.2736842, the most similar ligand is CHEMBL1037. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL1037 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | NC(=N)NCC1COC2(CCCCC2)O1 |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00000040 01000000 00100102 80210d00 00080080 00000004 00001800 00002000 00200200 00000022 00200000 40008000 00001200 00880000 00001008 00389008 20a00040 00000000 02c02000 00000001 00000020 10012000 17000080 08000010 10000402 00000000 40000000 24000020 00000212 00040000 00400000 00000200 |