On Target NOS2_HUMAN 0.30747128/CHEMBL1911986
For the given ligand Baloxavir, we have found in our database that, being scored 0.30747128, the most similar ligand is CHEMBL1911986. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL1911986 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Cc1cc(nc(n1)n2ccnc2)C3CCCN3C(=O)NCCc4ccc5OCOc5c4 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00000002 43801808 2010110a 40050e00 450010c4 80104012 13042004 08007107 00300900 000c08c0 4933800c 40018800 0800d003 20300000 01020401 002c800c 0020c008 06800002 80480048 00220a41 80240720 1c258400 258008c0 8150011c 40116400 c1000600 08120000 b0000080 0500130c 00460003 60088000 a00146a0 |