On Target SCN9A_HUMAN 0.5046729/CHEMBL4077213
For the given ligand Peramivir, we have found in our database that, being scored 0.5046729, the most similar ligand is CHEMBL4077213. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL4077213 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCCCCCCCCCC1NC(=N)NC2(CCCO2)C1C(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010040 01401000 00100100 00010d10 001c0040 00200000 00000004 00002000 00000200 01000182 00200000 40019000 1d009008 00884100 00080000 00181008 00a00000 00020000 01c02850 00000001 00000120 12016a14 01000080 00100018 00012402 00001002 40001000 10000000 00000210 00040011 800a0000 00000a00 |