On Target PRGR_HUMAN 0.3053435/CHEMBL503848
For the given ligand Peramivir, we have found in our database that, being scored 0.3053435, the most similar ligand is CHEMBL503848. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL503848 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)NC5CCCCC5)C(=O)CO |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010002 81401000 00100100 00091700 00281480 00008000 00000080 82000402 01000200 01100080 00200000 4001d000 04028028 00800100 00000400 001a0008 00820000 80080000 13412800 00022001 00000001 10040ed0 01008000 00520818 00200000 00001002 00404020 90200000 00000200 0304000b a4020000 02000200 |