On Target AA2AR_HUMAN 0.34411764/CHEMBL3929822
For the given ligand Baloxavir, we have found in our database that, being scored 0.34411764, the most similar ligand is CHEMBL3929822. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3929822 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | COc1cccc2c(nc(N)nc12)C(=O)N[C@H]3CCCc4cccnc34 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0000000a 01805808 6010410b 10850e10 01041124 00104004 030c2000 2a003007 00500900 400808c0 09398004 40858800 00008886 08700800 010204c5 020c010c 00042208 06000006 80602408 00220a01 c0120100 1c078628 20804840 0070011c 00146800 c0000601 08224060 90000080 0040030e 00c60003 e0048000 200046a0 |