On Target AA2AR_HUMAN 0.29891303/CHEMBL376542
For the given ligand Peramivir, we have found in our database that, being scored 0.29891303, the most similar ligand is CHEMBL376542. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL376542 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCNC(=O)[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(NC(=N)N)ncnc23 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 0007000a 01c01810 80180000 88090e20 001800e0 0000c000 00008c04 20002801 00400100 018000b2 0c20802c 4001f004 14009032 01880300 0008108a 381fc00c 10240020 80004800 99c00000 80201201 800a0020 10040670 378040c4 0c10003c 10100403 40090002 40000600 100000f1 00020219 00460001 c0280000 00000ac0 |