On Target CXCR1_HUMAN 0.234375/CHEMBL3701188
For the given ligand Laninamivir, we have found in our database that, being scored 0.234375, the most similar ligand is CHEMBL3701188. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL3701188 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | COC(=O)[C@H]1CCCN1C(=O)c2cccc(NC3=C(N[C@@H](c4oc(C)cc4)C5(C)COC5)C(=O)C3=O)c2O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 1041c08a 01205808 e0180102 00012700 24090081 68022018 020000a0 226d1500 05a04d40 001a08d0 00380034 5043b800 ce088c1a 01200008 800a1460 10086048 10a75001 22008c00 08e30210 26020201 48101980 18169e00 330000c0 0058801c 04841031 c0000280 24d00010 980c0581 20508302 a0064013 a4045420 40002600 |