On Target PGH2_HUMAN 0.31868133/CHEMBL463763
For the given ligand Zanamivir, we have found in our database that, being scored 0.31868133, the most similar ligand is CHEMBL463763. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL463763 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | CC(C)[C@]12O[C@H]1[C@@H]3O[C@@]34[C@@]5(C)CCC6=C(COC6=O)[C@@H]5C[C@@H]7O[C@]47[C@@H]2O |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00010040 81000000 00000100 80010300 003800c0 00000800 00000080 08000442 01002000 01100008 40040000 40009000 04028008 02800000 00000400 000a9008 00820010 00000020 13412010 00002001 00000020 10000a80 05008000 08000010 00201400 00000400 00404000 80000020 00000200 00000002 24020000 00800010 |