On Target TRY1_HUMAN 0.38308457/CHEMBL112726
For the given ligand Laninamivir, we have found in our database that, being scored 0.38308457, the most similar ligand is CHEMBL112726. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL112726 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CCCC(CCC)C(=O)N[C@@H](CC(=O)OC)C(=O)N1CCCC1C(=O)N[C@H]2CCCN(C2O)C(=N)N |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00070000 01007000 00100100 04010d00 00180080 00008010 00000000 20002008 00200600 00000082 00200000 5003b000 0e00b012 01002001 80180000 00180008 10230010 00000101 00c02010 00000201 00000000 30150e60 03000083 02100018 00001001 00000000 40001200 10000000 08000212 00040001 a00a4000 00802a00 |