On Target TRY1_HUMAN 0.3043478/CHEMBL117092
For the given ligand Baloxavir, we have found in our database that, being scored 0.3043478, the most similar ligand is CHEMBL117092. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL117092 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | NC(=N)N1CCC[C@H](NC(=O)CNC(=O)[C@@H](CCNC(=O)c2nccc3ccccc23)NS(=O)(=O)Cc4ccccc4)C1O |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00020082 05007c20 00106100 15312e00 000c80a0 00108000 00020004 2200b009 00200600 004009c6 0029240c 5003b000 0600f822 01542001 80920440 021c810c 10010018 02000102 00600000 00005603 c0040000 3c8f8648 23802003 b250003c 02100000 c0000008 40001040 9000000c 08000114 00060011 a00c4000 00814260 |