On Target ACE_HUMAN 0.32535884/CHEMBL284898
For the given ligand Laninamivir, we have found in our database that, being scored 0.32535884, the most similar ligand is CHEMBL284898. Check out the elaboration below.
| Laninamivir (Given Ligand) | CHEMBL284898 (Similar Ligand) |
|---|---|
| CO[C@H]([C@H](O)CO)[C@@H]1O/C(C(=O)O)=C\[C@H](NC(=N)N)[C@H]1NC(C)=O | CCOC(=O)C(CCc1ccccc1)OC(C)C(=O)N2C3CCCCC3CC2C(=O)O |
|
|
|
|
|
|
| 00000000 8904f200 00100101 84010d01 003c00c1 00200200 00080180 38802c48 01002600 011000ca 80200000 4001c000 8002b002 01892000 02001408 391b9008 30a10814 80000540 51c16010 00002201 20000020 70152fb0 17008080 0a10001c 00021403 88008c00 40c04200 90000121 0800c250 00040401 ac0e0000 00004a00 | 00010000 01005008 00100102 80010700 00080080 00000010 00000000 20000040 00002800 000808c0 08300000 4001f200 0600801a 01a00002 80281008 38091008 10820000 82000000 02402000 00000201 00000120 18040e10 17000040 0850001c 10000400 80000000 00000000 10000021 00000200 00060003 20024000 00402600 |