On Target ACE_HUMAN 0.29268292/CHEMBL148616
For the given ligand Baloxavir, we have found in our database that, being scored 0.29268292, the most similar ligand is CHEMBL148616. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL148616 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | C[C@H](CS)C(=O)N1Cc2[nH]c3ccccc3c2CC1C(=O)O |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0001801a 0080d800 00100100 51910e10 000410a0 00100000 01003000 02003005 00400880 00090840 08310004 4000b000 1e008882 00648800 800a04c0 020c010c 10000200 02000026 00600408 00400a01 c0020100 18218e08 23804240 91400018 00143801 c0000001 08004000 80000000 04000104 00860023 20044200 01016620 |